Home
Products
Phellodendrine chloride
| Product Name | Phellodendrine chloride |
| Price: | $77 / 20mg |
| Catalog No.: | CN02215 |
| CAS No.: | 104112-82-5 |
| Molecular Formula: | C20H24NO4.Cl |
| Molecular Weight: | 377.85 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The peels of Phellodendron amurense Rupr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C[N+]3(C)CCc4c([C@@H]3Cc2cc1O)cc(c(c4)OC)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phellodendrine chloride is a plant alkaloid found in Phellodendron amurense. Phellodendrine chloride suppresses the proliferation of KRAS mutated pancreatic cancer cells through inhibition of nutrients uptake via macropinocytosis [1]. |
| Exact Mass | 377.139374 |
| PSA | 58.92000 |
| Storage condition | 2-8°C |