Home
Products
Ganoderic acid N
| Product Name | Ganoderic acid N |
| Price: | $293 / 5mg |
| Catalog No.: | CN07795 |
| CAS No.: | 110241-19-5 |
| Molecular Formula: | C30H42O8 |
| Molecular Weight: | 530.65 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)(O)C)CC(C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid N is a natural terpenoid isolated from the Fungus Ganoderma lucidum[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 725.5±60.0 °C at 760 mmHg |
| Flash Point | 406.5±29.4 °C |
| Exact Mass | 530.287964 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±5.3 mmHg at 25°C |