Home
Products
Orientin-2''-O-p-trans-coumarate
| Product Name | Orientin-2''-O-p-trans-coumarate |
| Price: | $351 / 5mg |
| Catalog No.: | CN04577 |
| CAS No.: | 1229437-75-5 |
| Molecular Formula: | C30H26O13 |
| Molecular Weight: | 594.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Swertia mileensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)OC(=O)C=Cc1ccc(cc1)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Orientin-2''-O-p-trans-coumarate is a flavonoid found in Trigonella foenum-graecum, with potent antioxidant activity[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 923.8±65.0 °C at 760 mmHg |
| Flash Point | 305.1±27.8 °C |
| Exact Mass | 594.137329 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |