Home
Products
Rubrosterone
| Product Name | Rubrosterone |
| Price: | $1053 / 5mg |
| Catalog No.: | CN02403 |
| CAS No.: | 19466-41-2 |
| Molecular Formula: | C19H26O5 |
| Molecular Weight: | 334.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Achyranthes bidentata Blume |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=C2[C@@H]([C@@]3([C@H]1C[C@@H](O)[C@H](C3)O)C)CC[C@]1(C2(O)CCC1=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rubrosterone is a metabolite of insect metamorphosing substances, that can be isolated from Achyranthes rubrofuca and A. fmaiei (Amaranthaceae)[1]. |
| Density | 1.34g/cm3 |
| Boiling Point | 540.7ºC at 760mmHg |
| Flash Point | 294.8ºC |
| Exact Mass | 334.17800 |
| PSA | 94.83000 |
| LogP | 1.14390 |
| Vapour Pressure | 6.06E-14mmHg at 25°C |