Home
Products
Chebulic acid
| Product Name | Chebulic acid |
| Price: | $190 / 10mg |
| Catalog No.: | CN03899 |
| CAS No.: | 23725-05-5 |
| Molecular Formula: | C14H12O11 |
| Molecular Weight: | 356.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The fruits of Terminalia chebula |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)C[C@@H]([C@@H]1[C@H](OC(=O)c2c1c(O)c(c(c2)O)O)C(=O)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chebulic acid, a phenolcarboxylic acid compound isolated from Terminalia chebula, has potent anti-oxidant activity, which breaks the cross-links of proteins induced by advanced glycation end-products (AGEs) and inhibits the formation of AGEs. Chebulic acid is effective in controlling elevated metabolic parameters, oxidative stress and renal damage, supporting its beneficial effect in diabetic nephropathy[1][2]. |
| Density | 1.882 |
| Boiling Point | 755.9±60.0 °C(Predicted) |
| Exact Mass | 356.03800 |
| PSA | 198.89000 |