Home
Products
Crebanine
| Product Name | Crebanine |
| Price: | $117 / 10mg |
| Catalog No.: | CN02086 |
| CAS No.: | 25127-29-1 |
| Molecular Formula: | C20H21NO4 |
| Molecular Weight: | 339.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Stephania yunnanensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1C[C@H]1N(C)CCc3c1c2c1OCOc1c3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Crebanine, an alkaloid from Stephania venosa, induces G1 arrest and apoptosis in human cancer cells. Crebanine exhibits anti-inflammatory activity via suppressing MAPKs and Akt signaling. Crebanine also possesses antiarrhythmic effect[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 488.2±45.0 °C at 760 mmHg |
| Flash Point | 145.4±25.9 °C |
| Exact Mass | 339.147064 |
| PSA | 40.16000 |
| LogP | 3.98 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20℃ |