Home
Products
Prudomestin
| Product Name | Prudomestin |
| Price: | Inquiry |
| Catalog No.: | CN05400 |
| CAS No.: | 3443-28-5 |
| Molecular Formula: | C17H14O7 |
| Molecular Weight: | 330.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Prunus domestica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1oc2c(OC)c(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Prudomestin, isolated from the heartwood of Prunus domestica, shows potent xanthine oxidase (XO) inhibitory activity (IC50≈6 µM)[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 568.9±50.0 °C at 760 mmHg |
| Flash Point | 212.2±23.6 °C |
| Exact Mass | 330.073944 |
| PSA | 109.36000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |