Home
Products
beta-Eudesmol
| Product Name | beta-Eudesmol |
| Price: | $204 / 10mg |
| Catalog No.: | CN09520 |
| CAS No.: | 473-15-4 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Solid |
| Source: | The rhizomes of Atractylodes lancea (Thunb.) DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1CCC[C@]2([C@H]1C[C@@H](CC2)C(O)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Beta-Eudesmol is a natural oxygenated sesquiterpene, activates hTRPA1, with an EC50 of 32.5 μM. Beta-Eudesmol increases appetite through TRPA1[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 301.7±11.0 °C at 760 mmHg |
| Flash Point | 108.6±15.6 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 4.68 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8°C |