Home
Products
Boldine
| Product Name | Boldine |
| Price: | $62 / 20mg |
| Catalog No.: | CN01985 |
| CAS No.: | 476-70-0 |
| Molecular Formula: | C19H21NO4 |
| Molecular Weight: | 327.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Litsea glutinosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1O)C[C@H]1c3c2c(OC)c(O)cc3CCN1C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Boldine is an aporphine isoquinoline alkaloid extracted from the root of Litsea cubeba and also possesses these properties, including antioxidant, anti-inflammatory and cytoprotective effects. Boldine suppresses osteoclastogenesis, improves bone destruction by down-regulating the OPG/RANKL/RANK signal pathway and may be a potential therapeutic agent for rheumatoid arthritis[1]. |
| Target | OPG/RANKL/RANK[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 529.3±50.0 °C at 760 mmHg |
| Flash Point | 273.9±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 62.16000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |