Home
Products
Berbamine
| Product Name | Berbamine |
| Price: | $77 / 20mg |
| Catalog No.: | CN01982 |
| CAS No.: | 478-61-5 |
| Molecular Formula: | C37H40N2O6 |
| Molecular Weight: | 608.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Cocculus orbiculatus (L.) DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c3c1Oc1cc4c(cc1OC)CCN([C@H]4Cc1ccc(Oc4cc(C[C@H]3N(CC2)C)ccc4O)cc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Berbamine is a natural compound extracted from traditional Chinese medicine Barberry with anti-tumor, immunomodulatory and cardiovascular effects. Berbamine is a calcium channel blocker. |
| Target | NF-κB |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 707.0±60.0 °C at 760 mmHg |
| Flash Point | 381.4±32.9 °C |
| Exact Mass | 608.288635 |
| PSA | 72.86000 |
| LogP | 3.89 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |