Home
Products
Seneciphylline
| Product Name | Seneciphylline |
| Price: | Inquiry |
| Catalog No.: | CN01976 |
| CAS No.: | 480-81-9 |
| Molecular Formula: | C18H23NO5 |
| Molecular Weight: | 333.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Senecio scandens. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C1/CC(=C)[C@@](C)(O)C(=O)OCC2=CCN3[C@H]2[C@H](OC1=O)CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Seneciphylline is a toxic pyrrolizidine alkaloid in Senecio plants[1]. Seneciphylline significantly increases the activities of epoxide hydrase and glutathione-S-transferase but causes reduction of cytochrome P-450 and related monooxygenase activities[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 577.7±50.0 °C at 760 mmHg |
| Flash Point | 303.2±30.1 °C |
| Exact Mass | 333.157623 |
| PSA | 76.07000 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Storage condition | 2-8℃ |