Home
Products
Aromadendrene
| Product Name | Aromadendrene |
| Price: | Inquiry |
| Catalog No.: | CN09041 |
| CAS No.: | 489-39-4 |
| Molecular Formula: | C15H24 |
| Molecular Weight: | 204.4 g/mol |
| Purity: | > 95% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Salvia sclarea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]1[C@H](C1(C)C)CCC2=C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aromadendrene can be isolated from Eucalyptus globulus. Aromadendrene has antimicrobial activity[1]. |
| Density | 0.93g/cm3 |
| Boiling Point | 261-263ºC(lit.) |
| Flash Point | 106.5ºC |
| Exact Mass | 204.18800 |
| LogP | 4.27090 |
| Storage condition | 2-8°C |