Home
Products
Guaiol
| Product Name | Guaiol |
| Price: | $263 / 10mg |
| Catalog No.: | CN09274 |
| CAS No.: | 489-86-1 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The roots of Ferula ferulaeoides. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@H]1CC[C@H](CC2=C1CC[C@@H]2C)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Guaiol is a sesquiterpene alcohol that has been found in several traditional Chinese medicinal plants and has antiproliferative, pro-autophagic, insect repellent, and insecticidal biological activities[1][2][3]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 288.0±0.0 °C at 760 mmHg |
| Flash Point | 113.6±15.6 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 4.81 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |