Home
Products
Ganoderic acid LM2
| Product Name | Ganoderic acid LM2 |
| Price: | $277 / 5mg |
| Catalog No.: | CN07791 |
| CAS No.: | 508182-41-0 |
| Molecular Formula: | C30H42O7 |
| Molecular Weight: | 514.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(C=C(C(=O)O)C)CC(C1CC(=O)C2(C1(C)CC(=O)C1=C2C(O)CC2C1(C)CCC(=O)C2(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid LM2 is a natural terpenoid isolated from the Fungus Ganoderma lucidum. Ganoderic acid LM2 possesses potential anti-tumor activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 715.0±60.0 °C at 760 mmHg |
| Flash Point | 400.2±29.4 °C |
| Exact Mass | 514.293030 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |