Home
Products
Higenamine
| Product Name | Higenamine |
| Price: | $46 / 20mg |
| Catalog No.: | CN00724 |
| CAS No.: | 5843-65-2 |
| Molecular Formula: | C16H17NO3 |
| Molecular Weight: | 271.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)CC1NCCc2c1cc(O)c(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Higenamine (Norcoclaurine), a β2-AR agonist, is a key component of the Chinese herb aconite root that prescribes for treating symptoms of heart failure in the oriental Asian countries. Higenamine (Norcoclaurine) has anti-apoptotic effects[1][2]. |
| Target | β2-AR[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 522.4±50.0 °C at 760 mmHg |
| Flash Point | 209.6±20.7 °C |
| Exact Mass | 271.120850 |
| PSA | 72.72000 |
| LogP | 1.41 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |