Home
Products
Platycodin D
| Product Name | Platycodin D |
| Price: | $77 / 20mg |
| Catalog No.: | CN07984 |
| CAS No.: | 58479-68-8 |
| Molecular Formula: | C57H92O28 |
| Molecular Weight: | 1225.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Platycodon grandiflorum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1(CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O[C@@H]1OC[C@]([C@H]1O)(O)CO)O)O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Platycodin D is a saponin isolated from Platycodi Radix, acts as an activator of AMPKα, with anti-obesity property[1]. |
| Target | AMPKα[1] |
| Density | 1.6±0.1 g/cm3 |
| Exact Mass | 1224.577515 |
| PSA | 453.28000 |
| LogP | -0.69 |
| Storage condition | 2~8°C |