Home
Products
Patchouli alcohol
| Product Name | Patchouli alcohol |
| Price: | $31 / 20mg |
| Catalog No.: | CN09467 |
| CAS No.: | 5986-55-0 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Pogostemon cablin (Blanco) Benth. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@H]1CC[C@@]2([C@@]3([C@H]1C[C@H](C2(C)C)CC3)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Patchouli alcohol is a natural tricyclic sesquiterpene extracted from Pogostemon cablin (Blanco) Benth, and exhibits anti-Helicobacter pylori and anti-inflammatory properties[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 287.4±8.0 °C at 760 mmHg |
| Flash Point | 120.2±10.9 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 4.73 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |