Home
Products
Geissoschizine methyl ether
| Product Name | Geissoschizine methyl ether |
| Price: | $204 / 5mg |
| Catalog No.: | CN00847 |
| CAS No.: | 60314-89-8 |
| Molecular Formula: | C22H26N2O3 |
| Molecular Weight: | 366.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The hooks of Uncariae Ramulus et Uncus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO/C=C(/[C@H]1C[C@@H]2N(C/C/1=C/C)CCc1c2[nH]c2c1cccc2)C(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Geissoschizine methyl ether, a major indole alkaloid found in Uncaria hook, is a major active component of Yokukansan with psychotropic effects. Geissoschizine methyl ether is potent 5-HT1A receptor agonist[1][2]. |
| Target | 5-HT1A[2] |
| Density | 1.2±0.1 g/cm3, 计算值 |
| Exact Mass | 366.19400 |
| PSA | 54.56000 |
| LogP | 3.67450 |