Home
Products
4-Methoxyphenyl beta-D-glucopyranoside
| Product Name | 4-Methoxyphenyl beta-D-glucopyranoside |
| Price: | Inquiry |
| Catalog No.: | CN03760 |
| CAS No.: | 6032-32-2 |
| Molecular Formula: | C13H18O7 |
| Molecular Weight: | 286.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Lespedeza bicolor Turcz. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 519.0±50.0 °C at 760 mmHg |
| Flash Point | 267.7±30.1 °C |
| Exact Mass | 286.105255 |
| PSA | 108.61000 |
| LogP | -0.73 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |