Home
Products
Ginsenoside F2
| Product Name | Ginsenoside F2 |
| Price: | $85 / 20mg |
| Catalog No.: | CN08083 |
| CAS No.: | 62025-49-4 |
| Molecular Formula: | C42H72O13 |
| Molecular Weight: | 785.01 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(CO)C(C(C2O)O)O)(CCC=C(C)C)C)C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ginsenoside F2, a metabolite from Ginsenoside Rb1, induces apoptosis accompanied by protective autophagy in breast cancer stem cells[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 871.5±65.0 °C at 760 mmHg |
| Flash Point | 480.9±34.3 °C |
| Exact Mass | 784.497314 |
| PSA | 218.99000 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |