Home
Products
Lactupicrin
| Product Name | Lactupicrin |
| Price: | $336 / 10mg |
| Catalog No.: | CN09010 |
| CAS No.: | 65725-11-3 |
| Molecular Formula: | C23H22O7 |
| Molecular Weight: | 410.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lactuca laciniata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1=CC(=O)C2=C(C)C[C@@H]([C@@H]3[C@@H]([C@@H]12)OC(=O)C3=C)OC(=O)Cc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lactupicrin (Lactucopicrin) is a characteristic bitter sesquiterpene lactone that can relieve pain. Lactupicrin exhibits atheroprotective effect[1][2]. |
| Exact Mass | 410.13700 |
| PSA | 110.13000 |
| LogP | 1.78210 |